| Name | 2-Methyl-1-butanethiol |
| Synonyms | FEMA 3303 2-methyl-1-butanethio 2-methylbutane-1-thiol 2-Methyl-1-butanethiol 2-Methylbutyl mercaptan 2-methyl-butane-1-thiol 1-Butanethiol, 2-methyl- 1-Mercapto-2-methylbutane (2R)-2-methylbutane-1-thiol (2S)-2-methylbutane-1-thiol 2-METHYL-1-BUTANETHIOL FEMA NO.-------- |
| CAS | 1878-18-8 |
| EINECS | 217-515-3 |
| InChI | InChI=1/C5H12S/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3/t5-/m0/s1 |
| Molecular Formula | C5H12S |
| Molar Mass | 104.21 |
| Density | 0.848g/mLat 25°C(lit.) |
| Melting Point | -109.95°C (estimate) |
| Boling Point | 116-117°C(lit.) |
| Flash Point | 67°F |
| JECFA Number | 515 |
| Vapor Presure | 41.4 mm Hg ( 37.7 °C) |
| Appearance | liquid (estimate) |
| pKa | 10.41±0.10(Predicted) |
| Storage Condition | Flammables area |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.447(lit.) |
| Physical and Chemical Properties | Pale yellow lumpy solid, with sulfide odor, and broth fragrance when extremely thin. Melting point 118.2 ℃; Optical rotation [α]D23 3.21. |
| Risk Codes | R11 - Highly Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S33 - Take precautionary measures against static discharges. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | UN 1111 3/PG 2 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29309090 |
| Hazard Class | 3 |
| Packing Group | II |
| Toxicity | GRAS(FEMA)。 |
| toxicity | GRAS(FEMA). |
| usage limit | FEMA: soft drinks, candy, baked goods, meat and soup, milk, dairy products, cereal products, 0.8mg/kg |
| maximum allowable use amount of food additives maximum allowable residue standard | The Chinese name of the additive the Chinese name of the additive is allowed to use the food Chinese name of the additive function maximum allowable use amount (g/kg) maximum allowable residue (g/kg)2-methyl -1-butanethiol food flavoring ingredients used in the preparation of flavors shall not exceed the maximum allowable use and the maximum allowable residue in GB 2760 |
| Chemical properties | light yellow solid, with a bad smell of sulfide, in broth when very thin. Melting point 118.2 °c; Optical rotation [α]D23 3.21 °. |
| Use | GB 2760-1996 specifies temporary use of food flavors. |
| production method | conversion from 2-methyl-1-butylisothiourea picrate to BIS (2-methylbutyl) disulfide is then reduced from sodium metal in liquid ammonia. |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |